C18H30N2O — CID 143778310
ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidene-1-(2-pyrrolidin-1-ylethyl)piperidin-2-one (PubChem CID 143778310) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidene-1-(2-pyrrolidin-1-ylethyl)piperidin-2-one.
| Compound Name | ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidene-1-(2-pyrrolidin-1-ylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 143778310 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidene-1-(2-pyrrolidin-1-ylethyl)piperidin-2-one |
| SMILES | C=C/C=C1/C(=O)N(CCN2CCCC2)CC/C1=C/C.CC |
| InChI | InChI=1S/C16H24N2O.C2H6/c1-3-7-15-14(4-2)8-11-18(16(15)19)13-12-17-9-5-6-10-17;1-2/h3-4,7H,1,5-6,8-13H2,2H3;1-2H3/b14-4-,15-7+; |
| InChIKey | LGOWBXXFVSCCTJ-JSBJBEMDSA-N |
| XLogP | 3.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|