C10H15NS2 — CID 143778536
ethane;6-methyl-3a,7a-dihydro-3H-1,3-benzothiazole-2-thione (PubChem CID 143778536) has the molecular formula C10H15NS2 and a molecular weight of 213.37 g/mol. Its IUPAC name is ethane;6-methyl-3a,7a-dihydro-3H-1,3-benzothiazole-2-thione.
| Compound Name | ethane;6-methyl-3a,7a-dihydro-3H-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 143778536 |
| Molecular Formula | C10H15NS2 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | ethane;6-methyl-3a,7a-dihydro-3H-1,3-benzothiazole-2-thione |
| SMILES | CC.CC1=CC2SC(=S)NC2C=C1 |
| InChI | InChI=1S/C8H9NS2.C2H6/c1-5-2-3-6-7(4-5)11-8(10)9-6;1-2/h2-4,6-7H,1H3,(H,9,10);1-2H3 |
| InChIKey | ILUOIDGJDVWIAB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|