C9H10O4 — CID 175022944
(1R,2S)-4-methylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 175022944) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is (1R,2S)-4-methylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | (1R,2S)-4-methylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175022944 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1R,2S)-4-methylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | CC1=C[C@H](C(=O)O)[C@H](C(=O)O)C=C1 |
| InChI | InChI=1S/C9H10O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4,6-7H,1H3,(H,10,11)(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | URGXDZXBMIASOD-RQJHMYQMSA-N |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |