About (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid
(1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 24745711) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 24745711 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC(C)[C@@H]1C=CC(c2ccccc2)=C[C@H]1C(=O)O |
| InChI | InChI=1S/C16H18O2/c1-11(2)14-9-8-13(10-15(14)16(17)18)12-6-4-3-5-7-12/h3-11,14-15H,1-2H3,(H,17,18)/t14-,15+/m0/s1 |
| InChIKey | XXFRPTZRMKOZPW-LSDHHAIUSA-N |
| XLogP | 3.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid (CID 24745711) is (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid is CC(C)[C@@H]1C=CC(c2ccccc2)=C[C@H]1C(=O)O.
What is the InChIKey of (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is XXFRPTZRMKOZPW-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H18O2/c1-11(2)14-9-8-13(10-15(14)16(17)18)12-6-4-3-5-7-12/h3-11,14-15H,1-2H3,(H,17,18)/t14-,15+/m0/s1.
What are the key properties of (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid?
(1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 242.32 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-3-phenyl-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 24745711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).