C20H17NO3 — CID 154091071
6-amino-6-benzoyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 154091071) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 6-amino-6-benzoyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-amino-6-benzoyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 154091071 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-amino-6-benzoyl-4-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1(C(=O)c2ccccc2)C=C(c2ccccc2)C=CC1C(=O)O |
| InChI | InChI=1S/C20H17NO3/c21-20(18(22)15-9-5-2-6-10-15)13-16(11-12-17(20)19(23)24)14-7-3-1-4-8-14/h1-13,17H,21H2,(H,23,24) |
| InChIKey | PAIAXDKBOKIMAG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |