C10H16O — CID 90828048
1-(4,6-dimethylcyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 90828048) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-(4,6-dimethylcyclohexa-2,4-dien-1-yl)ethanol.
| Compound Name | 1-(4,6-dimethylcyclohexa-2,4-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 90828048 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-(4,6-dimethylcyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | CC1=CC(C)C(C(C)O)C=C1 |
| InChI | InChI=1S/C10H16O/c1-7-4-5-10(9(3)11)8(2)6-7/h4-6,8-11H,1-3H3 |
| InChIKey | NLBQBYFAUZEOJP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |