C11H16 — CID 142132615
2,5-dimethyl-6-[(E)-prop-1-enyl]cyclohexa-1,3-diene (PubChem CID 142132615) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 2,5-dimethyl-6-[(E)-prop-1-enyl]cyclohexa-1,3-diene.
| Compound Name | 2,5-dimethyl-6-[(E)-prop-1-enyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142132615 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 2,5-dimethyl-6-[(E)-prop-1-enyl]cyclohexa-1,3-diene |
| SMILES | C/C=C/C1C=C(C)C=CC1C |
| InChI | InChI=1S/C11H16/c1-4-5-11-8-9(2)6-7-10(11)3/h4-8,10-11H,1-3H3/b5-4+ |
| InChIKey | NZNFKSWQAZNRMQ-SNAWJCMRSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|