C14H26N6O2 — CID 143778550
ethane;3,7,9-trimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 143778550) has the molecular formula C14H26N6O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is ethane;3,7,9-trimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | ethane;3,7,9-trimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 143778550 |
| Molecular Formula | C14H26N6O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethane;3,7,9-trimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC.CC.CC1=NNC2=NC3C(C(=O)N(C)C(=O)N3C)N2C1 |
| InChI | InChI=1S/C10H14N6O2.2C2H6/c1-5-4-16-6-7(11-9(16)13-12-5)14(2)10(18)15(3)8(6)17;2*1-2/h6-7H,4H2,1-3H3,(H,11,13);2*1-2H3 |
| InChIKey | ASQPLZFDXLIUOA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |