About ethane;6-methyl-7aH-inden-5-ol
ethane;6-methyl-7aH-inden-5-ol (PubChem CID 143778579) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;6-methyl-7aH-inden-5-ol.
Molecular Properties
| Compound Name | ethane;6-methyl-7aH-inden-5-ol |
| PubChem CID | 143778579 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | ethane;6-methyl-7aH-inden-5-ol |
| SMILES | CC.CC1=CC2C=CC=C2C=C1O |
| InChI | InChI=1S/C10H10O.C2H6/c1-7-5-8-3-2-4-9(8)6-10(7)11;1-2/h2-6,8,11H,1H3;1-2H3 |
| InChIKey | JEZBLKQDAZQTQK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-methyl-7aH-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-7aH-inden-5-ol?
The IUPAC name of ethane;6-methyl-7aH-inden-5-ol (CID 143778579) is ethane;6-methyl-7aH-inden-5-ol.
What is the SMILES notation for ethane;6-methyl-7aH-inden-5-ol?
The canonical SMILES for ethane;6-methyl-7aH-inden-5-ol is CC.CC1=CC2C=CC=C2C=C1O.
What is the InChIKey of ethane;6-methyl-7aH-inden-5-ol?
The InChIKey is JEZBLKQDAZQTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O.C2H6/c1-7-5-8-3-2-4-9(8)6-10(7)11;1-2/h2-6,8,11H,1H3;1-2H3.
What are the key properties of ethane;6-methyl-7aH-inden-5-ol?
ethane;6-methyl-7aH-inden-5-ol has a molecular weight of 176.26 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-7aH-inden-5-ol is sourced from PubChem (CID 143778579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).