C22H32N2O5 — CID 143779037
5-methoxy-3-[1-[4-(2-methoxyethoxy)cyclohexyl]piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 143779037) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is 5-methoxy-3-[1-[4-(2-methoxyethoxy)cyclohexyl]piperidin-4-yl]-1,3-benzoxazol-2-one.
| Compound Name | 5-methoxy-3-[1-[4-(2-methoxyethoxy)cyclohexyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 143779037 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 5-methoxy-3-[1-[4-(2-methoxyethoxy)cyclohexyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | COCCOC1CCC(N2CCC(n3c(=O)oc4ccc(OC)cc43)CC2)CC1 |
| InChI | InChI=1S/C22H32N2O5/c1-26-13-14-28-18-5-3-16(4-6-18)23-11-9-17(10-12-23)24-20-15-19(27-2)7-8-21(20)29-22(24)25/h7-8,15-18H,3-6,9-14H2,1-2H3 |
| InChIKey | HNIBMFHDWFUKMT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|