C19H28N12O2 — CID 143780293
N'-[amino(propyl)amino]methanimidamide;N-[7-formyl-4-oxo-3-[(2R)-1-(tetrazol-2-yl)propan-2-yl]quinazolin-6-yl]-N'-methylmethanimidamide (PubChem CID 143780293) has the molecular formula C19H28N12O2 and a molecular weight of 456.52 g/mol. Its IUPAC name is N'-[amino(propyl)amino]methanimidamide;N-[7-formyl-4-oxo-3-[(2R)-1-(tetrazol-2-yl)propan-2-yl]quinazolin-6-yl]-N'-methylmethanimidamide.
| Compound Name | N'-[amino(propyl)amino]methanimidamide;N-[7-formyl-4-oxo-3-[(2R)-1-(tetrazol-2-yl)propan-2-yl]quinazolin-6-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143780293 |
| Molecular Formula | C19H28N12O2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N'-[amino(propyl)amino]methanimidamide;N-[7-formyl-4-oxo-3-[(2R)-1-(tetrazol-2-yl)propan-2-yl]quinazolin-6-yl]-N'-methylmethanimidamide |
| SMILES | C/N=C/Nc1cc2c(=O)n([C@H](C)Cn3ncnn3)cnc2cc1C=O.CCCN(N)/N=C\N |
| InChI | InChI=1S/C15H16N8O2.C4H12N4/c1-10(5-23-20-8-19-21-23)22-9-18-14-3-11(6-24)13(17-7-16-2)4-12(14)15(22)25;1-2-3-8(6)7-4-5/h3-4,6-10H,5H2,1-2H3,(H,16,17);4H,2-3,6H2,1H3,(H2,5,7)/t10-;/m1./s1 |
| InChIKey | NUXWZLWQOLHETC-HNCPQSOCSA-N |
| XLogP | 0.00 |
| TPSA | 187.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|