C23H30N2O5S — CID 58967469
methyl 3-cyclohexyl-2-(7-cyclopentylsulfonyl-4-oxoquinazolin-3-yl)propanoate (PubChem CID 58967469) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-(7-cyclopentylsulfonyl-4-oxoquinazolin-3-yl)propanoate.
| Compound Name | methyl 3-cyclohexyl-2-(7-cyclopentylsulfonyl-4-oxoquinazolin-3-yl)propanoate |
|---|---|
| PubChem CID | 58967469 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | methyl 3-cyclohexyl-2-(7-cyclopentylsulfonyl-4-oxoquinazolin-3-yl)propanoate |
| SMILES | COC(=O)C(CC1CCCCC1)n1cnc2cc(S(=O)(=O)C3CCCC3)ccc2c1=O |
| InChI | InChI=1S/C23H30N2O5S/c1-30-23(27)21(13-16-7-3-2-4-8-16)25-15-24-20-14-18(11-12-19(20)22(25)26)31(28,29)17-9-5-6-10-17/h11-12,14-17,21H,2-10,13H2,1H3 |
| InChIKey | UPRSHZVEMYZWOT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |