About ethane;6-fluoro-5-methyl-3,4-dihydropyridine
ethane;6-fluoro-5-methyl-3,4-dihydropyridine (PubChem CID 143782199) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is ethane;6-fluoro-5-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | ethane;6-fluoro-5-methyl-3,4-dihydropyridine |
| PubChem CID | 143782199 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | ethane;6-fluoro-5-methyl-3,4-dihydropyridine |
| SMILES | CC.CC1=C(F)N=CCC1 |
| InChI | InChI=1S/C6H8FN.C2H6/c1-5-3-2-4-8-6(5)7;1-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | QGIBZVVBLFPBOD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-fluoro-5-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-fluoro-5-methyl-3,4-dihydropyridine?
The IUPAC name of ethane;6-fluoro-5-methyl-3,4-dihydropyridine (CID 143782199) is ethane;6-fluoro-5-methyl-3,4-dihydropyridine.
What is the SMILES notation for ethane;6-fluoro-5-methyl-3,4-dihydropyridine?
The canonical SMILES for ethane;6-fluoro-5-methyl-3,4-dihydropyridine is CC.CC1=C(F)N=CCC1.
What is the InChIKey of ethane;6-fluoro-5-methyl-3,4-dihydropyridine?
The InChIKey is QGIBZVVBLFPBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN.C2H6/c1-5-3-2-4-8-6(5)7;1-2/h4H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;6-fluoro-5-methyl-3,4-dihydropyridine?
ethane;6-fluoro-5-methyl-3,4-dihydropyridine has a molecular weight of 143.20 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-fluoro-5-methyl-3,4-dihydropyridine is sourced from PubChem (CID 143782199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).