C8H12N2 — CID 174336590
N-(5-ethyl-3,4-dihydropyridin-6-yl)methanimine (PubChem CID 174336590) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N-(5-ethyl-3,4-dihydropyridin-6-yl)methanimine.
| Compound Name | N-(5-ethyl-3,4-dihydropyridin-6-yl)methanimine |
|---|---|
| PubChem CID | 174336590 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-(5-ethyl-3,4-dihydropyridin-6-yl)methanimine |
| SMILES | C=NC1=C(CC)CCC=N1 |
| InChI | InChI=1S/C8H12N2/c1-3-7-5-4-6-10-8(7)9-2/h6H,2-5H2,1H3 |
| InChIKey | FHNWVFKGNLGYLX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|