C25H28Cl2F2N3OP — CID 143782592
[2-[(3,4-dichlorophenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-[difluoro(phosphanyl)methyl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 143782592) has the molecular formula C25H28Cl2F2N3OP and a molecular weight of 526.40 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-[difluoro(phosphanyl)methyl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [2-[(3,4-dichlorophenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-[difluoro(phosphanyl)methyl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 143782592 |
| Molecular Formula | C25H28Cl2F2N3OP |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-[difluoro(phosphanyl)methyl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)P)cc2C1)C12CCCC1CC(NCc1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C25H28Cl2F2N3OP/c26-20-4-3-15(8-21(20)27)12-30-19-10-17-2-1-6-24(17,11-19)23(33)32-7-5-22-16(14-32)9-18(13-31-22)25(28,29)34/h3-4,8-9,13,17,19,30H,1-2,5-7,10-12,14,34H2 |
| InChIKey | NXTGLKUFBGSWKO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|