C29H32F3NO2S — CID 143784288
N-[2-[4-(2,4-dimethoxyphenyl)-3-methylphenyl]prop-2-enyl]-1-[2-(2,2,2-trifluoroethyl)phenyl]ethanimine;methanethiol (PubChem CID 143784288) has the molecular formula C29H32F3NO2S and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[2-[4-(2,4-dimethoxyphenyl)-3-methylphenyl]prop-2-enyl]-1-[2-(2,2,2-trifluoroethyl)phenyl]ethanimine;methanethiol.
| Compound Name | N-[2-[4-(2,4-dimethoxyphenyl)-3-methylphenyl]prop-2-enyl]-1-[2-(2,2,2-trifluoroethyl)phenyl]ethanimine;methanethiol |
|---|---|
| PubChem CID | 143784288 |
| Molecular Formula | C29H32F3NO2S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N-[2-[4-(2,4-dimethoxyphenyl)-3-methylphenyl]prop-2-enyl]-1-[2-(2,2,2-trifluoroethyl)phenyl]ethanimine;methanethiol |
| SMILES | C=C(C/N=C(\C)c1ccccc1CC(F)(F)F)c1ccc(-c2ccc(OC)cc2OC)c(C)c1.CS |
| InChI | InChI=1S/C28H28F3NO2.CH4S/c1-18-14-21(10-12-24(18)26-13-11-23(33-4)15-27(26)34-5)19(2)17-32-20(3)25-9-7-6-8-22(25)16-28(29,30)31;1-2/h6-15H,2,16-17H2,1,3-5H3;2H,1H3/b32-20+; |
| InChIKey | GIJXQERNJBMJET-AFMAXSDVSA-N |
| XLogP | 7.85 |
| TPSA | 30.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|