C26H31NOS — CID 143784293
1-(2-ethylphenyl)-N-methylethanimine;3-(2-methoxy-4-prop-1-en-2-ylphenyl)-4-methylthiophene (PubChem CID 143784293) has the molecular formula C26H31NOS and a molecular weight of 405.61 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-N-methylethanimine;3-(2-methoxy-4-prop-1-en-2-ylphenyl)-4-methylthiophene.
| Compound Name | 1-(2-ethylphenyl)-N-methylethanimine;3-(2-methoxy-4-prop-1-en-2-ylphenyl)-4-methylthiophene |
|---|---|
| PubChem CID | 143784293 |
| Molecular Formula | C26H31NOS |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-(2-ethylphenyl)-N-methylethanimine;3-(2-methoxy-4-prop-1-en-2-ylphenyl)-4-methylthiophene |
| SMILES | C=C(C)c1ccc(-c2cscc2C)c(OC)c1.CCc1ccccc1/C(C)=N/C |
| InChI | InChI=1S/C15H16OS.C11H15N/c1-10(2)12-5-6-13(15(7-12)16-4)14-9-17-8-11(14)3;1-4-10-7-5-6-8-11(10)9(2)12-3/h5-9H,1H2,2-4H3;5-8H,4H2,1-3H3/b;12-9+ |
| InChIKey | MLDKPHOPIUQDCC-UWHSOXSGSA-N |
| XLogP | 7.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|