C18H30N3O2P — CID 143784587
tert-butyl 4-[[(2,5-dimethyl-4-pyridinyl)amino]methyl]-4-phosphanylpiperidine-1-carboxylate (PubChem CID 143784587) has the molecular formula C18H30N3O2P and a molecular weight of 351.43 g/mol. Its IUPAC name is tert-butyl 4-[[(2,5-dimethyl-4-pyridinyl)amino]methyl]-4-phosphanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2,5-dimethyl-4-pyridinyl)amino]methyl]-4-phosphanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143784587 |
| Molecular Formula | C18H30N3O2P |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | tert-butyl 4-[[(2,5-dimethyl-4-pyridinyl)amino]methyl]-4-phosphanylpiperidine-1-carboxylate |
| SMILES | Cc1cc(NCC2(P)CCN(C(=O)OC(C)(C)C)CC2)c(C)cn1 |
| InChI | InChI=1S/C18H30N3O2P/c1-13-11-19-14(2)10-15(13)20-12-18(24)6-8-21(9-7-18)16(22)23-17(3,4)5/h10-11H,6-9,12,24H2,1-5H3,(H,19,20) |
| InChIKey | HIDWJLGNDOBWKV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|