C10H18N2 — CID 143787035
N-(2,3-dihydropyridin-6-ylmethyl)-N-ethylethanamine (PubChem CID 143787035) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-6-ylmethyl)-N-ethylethanamine.
| Compound Name | N-(2,3-dihydropyridin-6-ylmethyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 143787035 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-(2,3-dihydropyridin-6-ylmethyl)-N-ethylethanamine |
| SMILES | CCN(CC)CC1=NCCC=C1 |
| InChI | InChI=1S/C10H18N2/c1-3-12(4-2)9-10-7-5-6-8-11-10/h5,7H,3-4,6,8-9H2,1-2H3 |
| InChIKey | MLQJXNVURPSBGM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |