About 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone
1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone (PubChem CID 1437874) has the molecular formula C23H22N4O
and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone |
| PubChem CID | 1437874 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ccc(Cn3c(C)nc4cc(N)c(C)nc43)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O/c1-14-21(24)12-22-23(25-14)27(16(3)26-22)13-17-4-6-19(7-5-17)20-10-8-18(9-11-20)15(2)28/h4-12H,13,24H2,1-3H3 |
| InChIKey | OCEBEYZKSLTKGZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone?
The IUPAC name of 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone (CID 1437874) is 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone.
What is the SMILES notation for 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone?
The canonical SMILES for 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone is CC(=O)c1ccc(-c2ccc(Cn3c(C)nc4cc(N)c(C)nc43)cc2)cc1.
What is the InChIKey of 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone?
The InChIKey is OCEBEYZKSLTKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O/c1-14-21(24)12-22-23(25-14)27(16(3)26-22)13-17-4-6-19(7-5-17)20-10-8-18(9-11-20)15(2)28/h4-12H,13,24H2,1-3H3.
What are the key properties of 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone?
1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone has a molecular weight of 370.46 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-[(6-amino-2,5-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]phenyl]ethanone is sourced from PubChem (CID 1437874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).