C16H16N3O3P — CID 155205659
[4-[(5-carbamoyl-2-methylbenzimidazol-1-yl)methyl]phenyl]phosphonous acid (PubChem CID 155205659) has the molecular formula C16H16N3O3P and a molecular weight of 329.30 g/mol. Its IUPAC name is [4-[(5-carbamoyl-2-methylbenzimidazol-1-yl)methyl]phenyl]phosphonous acid.
| Compound Name | [4-[(5-carbamoyl-2-methylbenzimidazol-1-yl)methyl]phenyl]phosphonous acid |
|---|---|
| PubChem CID | 155205659 |
| Molecular Formula | C16H16N3O3P |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [4-[(5-carbamoyl-2-methylbenzimidazol-1-yl)methyl]phenyl]phosphonous acid |
| SMILES | Cc1nc2cc(C(N)=O)ccc2n1Cc1ccc(P(O)O)cc1 |
| InChI | InChI=1S/C16H16N3O3P/c1-10-18-14-8-12(16(17)20)4-7-15(14)19(10)9-11-2-5-13(6-3-11)23(21)22/h2-8,21-22H,9H2,1H3,(H2,17,20) |
| InChIKey | UQAGKIAULUNBQL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|