C17H18BN3O4 — CID 169006311
[4-[(5-carbamoyl-2-ethylbenzimidazol-1-yl)methyl]phenoxy]boronic acid (PubChem CID 169006311) has the molecular formula C17H18BN3O4 and a molecular weight of 339.16 g/mol. Its IUPAC name is [4-[(5-carbamoyl-2-ethylbenzimidazol-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(5-carbamoyl-2-ethylbenzimidazol-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006311 |
| Molecular Formula | C17H18BN3O4 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [4-[(5-carbamoyl-2-ethylbenzimidazol-1-yl)methyl]phenoxy]boronic acid |
| SMILES | CCc1nc2cc(C(N)=O)ccc2n1Cc1ccc(OB(O)O)cc1 |
| InChI | InChI=1S/C17H18BN3O4/c1-2-16-20-14-9-12(17(19)22)5-8-15(14)21(16)10-11-3-6-13(7-4-11)25-18(23)24/h3-9,23-24H,2,10H2,1H3,(H2,19,22) |
| InChIKey | IAHKIOCOYFMZSL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|