C15H15N3OS — CID 155949376
N,2-dimethyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 155949376) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is N,2-dimethyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N,2-dimethyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155949376 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N,2-dimethyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)nc(C)n2Cc1ccsc1 |
| InChI | InChI=1S/C15H15N3OS/c1-10-17-13-7-12(15(19)16-2)3-4-14(13)18(10)8-11-5-6-20-9-11/h3-7,9H,8H2,1-2H3,(H,16,19) |
| InChIKey | SHHNTSSGEUJHDP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |