C10H15N3 — CID 143791087
2,6-dimethylpyrazolo[1,5-b]pyridazine;ethane (PubChem CID 143791087) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,6-dimethylpyrazolo[1,5-b]pyridazine;ethane.
| Compound Name | 2,6-dimethylpyrazolo[1,5-b]pyridazine;ethane |
|---|---|
| PubChem CID | 143791087 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2,6-dimethylpyrazolo[1,5-b]pyridazine;ethane |
| SMILES | CC.Cc1ccc2cc(C)nn2n1 |
| InChI | InChI=1S/C8H9N3.C2H6/c1-6-3-4-8-5-7(2)10-11(8)9-6;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | XYIYPNMNOJQTEQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |