About 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane
2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane (PubChem CID 144895132) has the molecular formula C11H15F2N3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane |
| PubChem CID | 144895132 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane |
| SMILES | CC.Cc1ccc2nc(C(F)F)c(C)n2n1 |
| InChI | InChI=1S/C9H9F2N3.C2H6/c1-5-3-4-7-12-8(9(10)11)6(2)14(7)13-5;1-2/h3-4,9H,1-2H3;1-2H3 |
| InChIKey | GYIGCXPVGZOXJO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane?
The IUPAC name of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane (CID 144895132) is 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane.
What is the SMILES notation for 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane?
The canonical SMILES for 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane is CC.Cc1ccc2nc(C(F)F)c(C)n2n1.
What is the InChIKey of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane?
The InChIKey is GYIGCXPVGZOXJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N3.C2H6/c1-5-3-4-7-12-8(9(10)11)6(2)14(7)13-5;1-2/h3-4,9H,1-2H3;1-2H3.
What are the key properties of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane?
2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane has a molecular weight of 227.26 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine;ethane is sourced from PubChem (CID 144895132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).