C18H21N3 — CID 135217296
3-(3,4-diethylphenyl)-2,6-dimethylimidazo[1,2-b]pyridazine (PubChem CID 135217296) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 3-(3,4-diethylphenyl)-2,6-dimethylimidazo[1,2-b]pyridazine.
| Compound Name | 3-(3,4-diethylphenyl)-2,6-dimethylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 135217296 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-(3,4-diethylphenyl)-2,6-dimethylimidazo[1,2-b]pyridazine |
| SMILES | CCc1ccc(-c2c(C)nc3ccc(C)nn23)cc1CC |
| InChI | InChI=1S/C18H21N3/c1-5-14-8-9-16(11-15(14)6-2)18-13(4)19-17-10-7-12(3)20-21(17)18/h7-11H,5-6H2,1-4H3 |
| InChIKey | FUUCHKXLHHRSQV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |