C15H15N3O — CID 135217476
[4-(2,6-dimethylimidazo[1,2-b]pyridazin-3-yl)phenyl]methanol (PubChem CID 135217476) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is [4-(2,6-dimethylimidazo[1,2-b]pyridazin-3-yl)phenyl]methanol.
| Compound Name | [4-(2,6-dimethylimidazo[1,2-b]pyridazin-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 135217476 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | [4-(2,6-dimethylimidazo[1,2-b]pyridazin-3-yl)phenyl]methanol |
| SMILES | Cc1ccc2nc(C)c(-c3ccc(CO)cc3)n2n1 |
| InChI | InChI=1S/C15H15N3O/c1-10-3-8-14-16-11(2)15(18(14)17-10)13-6-4-12(9-19)5-7-13/h3-8,19H,9H2,1-2H3 |
| InChIKey | NKGYDESNZOZACZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |