C12H17N3 — CID 143791959
3-piperidin-4-yl-2,3-dihydro-1H-indazole (PubChem CID 143791959) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-piperidin-4-yl-2,3-dihydro-1H-indazole.
| Compound Name | 3-piperidin-4-yl-2,3-dihydro-1H-indazole |
|---|---|
| PubChem CID | 143791959 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-piperidin-4-yl-2,3-dihydro-1H-indazole |
| SMILES | c1ccc2c(c1)NNC2C1CCNCC1 |
| InChI | InChI=1S/C12H17N3/c1-2-4-11-10(3-1)12(15-14-11)9-5-7-13-8-6-9/h1-4,9,12-15H,5-8H2 |
| InChIKey | GNEWHJYLCBYLGW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |