C29H39N5O4 — CID 143792937
3-[2-[2-tert-butyl-4-(3-methoxypropylamino)pyrimidin-5-yl]-2-oxoethyl]-5-(2,3-dihydroindole-1-carbonyl)piperidine-1-carbaldehyde (PubChem CID 143792937) has the molecular formula C29H39N5O4 and a molecular weight of 521.66 g/mol. Its IUPAC name is 3-[2-[2-tert-butyl-4-(3-methoxypropylamino)pyrimidin-5-yl]-2-oxoethyl]-5-(2,3-dihydroindole-1-carbonyl)piperidine-1-carbaldehyde.
| Compound Name | 3-[2-[2-tert-butyl-4-(3-methoxypropylamino)pyrimidin-5-yl]-2-oxoethyl]-5-(2,3-dihydroindole-1-carbonyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 143792937 |
| Molecular Formula | C29H39N5O4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 3-[2-[2-tert-butyl-4-(3-methoxypropylamino)pyrimidin-5-yl]-2-oxoethyl]-5-(2,3-dihydroindole-1-carbonyl)piperidine-1-carbaldehyde |
| SMILES | COCCCNc1nc(C(C)(C)C)ncc1C(=O)CC1CC(C(=O)N2CCc3ccccc32)CN(C=O)C1 |
| InChI | InChI=1S/C29H39N5O4/c1-29(2,3)28-31-16-23(26(32-28)30-11-7-13-38-4)25(36)15-20-14-22(18-33(17-20)19-35)27(37)34-12-10-21-8-5-6-9-24(21)34/h5-6,8-9,16,19-20,22H,7,10-15,17-18H2,1-4H3,(H,30,31,32) |
| InChIKey | RRZBGPQKPHYPMZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|