C20H32N2O3 — CID 143795462
[4-(4-methylpentanoylamino)phenyl]methyl N-methyl-N-(3-methylbutan-2-yl)carbamate (PubChem CID 143795462) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is [4-(4-methylpentanoylamino)phenyl]methyl N-methyl-N-(3-methylbutan-2-yl)carbamate.
| Compound Name | [4-(4-methylpentanoylamino)phenyl]methyl N-methyl-N-(3-methylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 143795462 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [4-(4-methylpentanoylamino)phenyl]methyl N-methyl-N-(3-methylbutan-2-yl)carbamate |
| SMILES | CC(C)CCC(=O)Nc1ccc(COC(=O)N(C)C(C)C(C)C)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-14(2)7-12-19(23)21-18-10-8-17(9-11-18)13-25-20(24)22(6)16(5)15(3)4/h8-11,14-16H,7,12-13H2,1-6H3,(H,21,23) |
| InChIKey | UEBYNSCONRUQAE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |