C23H34N2O9 — CID 164901996
[4-[3-[(2R,4S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropanoylamino]phenyl]methyl N-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 164901996) has the molecular formula C23H34N2O9 and a molecular weight of 482.53 g/mol. Its IUPAC name is [4-[3-[(2R,4S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropanoylamino]phenyl]methyl N-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | [4-[3-[(2R,4S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropanoylamino]phenyl]methyl N-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 164901996 |
| Molecular Formula | C23H34N2O9 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [4-[3-[(2R,4S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypropanoylamino]phenyl]methyl N-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](C=O)N(C)C(=O)OCc1ccc(NC(=O)CCO[C@@H]2O[C@H](C)C(O)[C@H](O)C2O)cc1 |
| InChI | InChI=1S/C23H34N2O9/c1-13(2)17(11-26)25(4)23(31)33-12-15-5-7-16(8-6-15)24-18(27)9-10-32-22-21(30)20(29)19(28)14(3)34-22/h5-8,11,13-14,17,19-22,28-30H,9-10,12H2,1-4H3,(H,24,27)/t14-,17-,19?,20+,21?,22-/m1/s1 |
| InChIKey | APYNGNFAZUSTGS-VSNWPCOYSA-N |
| XLogP | 0.65 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|