C23H27FN2O6 — CID 162525139
(2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoic acid (PubChem CID 162525139) has the molecular formula C23H27FN2O6 and a molecular weight of 446.48 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoic acid.
| Compound Name | (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoic acid |
|---|---|
| PubChem CID | 162525139 |
| Molecular Formula | C23H27FN2O6 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoic acid |
| SMILES | CCCOC[C@@H](C(=O)O)N(C)C(=O)OCc1ccc(NC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H27FN2O6/c1-3-12-31-15-20(22(28)29)26(2)23(30)32-14-17-6-10-19(11-7-17)25-21(27)13-16-4-8-18(24)9-5-16/h4-11,20H,3,12-15H2,1-2H3,(H,25,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | QSXKQVIRSVYCJL-FQEVSTJZSA-N |
| XLogP | 3.46 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|