C25H28FN3O6 — CID 162525142
cyanomethyl (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoate (PubChem CID 162525142) has the molecular formula C25H28FN3O6 and a molecular weight of 485.51 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoate.
| Compound Name | cyanomethyl (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoate |
|---|---|
| PubChem CID | 162525142 |
| Molecular Formula | C25H28FN3O6 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | cyanomethyl (2S)-2-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]methoxycarbonyl-methylamino]-3-propoxypropanoate |
| SMILES | CCCOC[C@@H](C(=O)OCC#N)N(C)C(=O)OCc1ccc(NC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H28FN3O6/c1-3-13-33-17-22(24(31)34-14-12-27)29(2)25(32)35-16-19-6-10-21(11-7-19)28-23(30)15-18-4-8-20(26)9-5-18/h4-11,22H,3,13-17H2,1-2H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | FBRRNKMJLRQTQD-QFIPXVFZSA-N |
| XLogP | 3.44 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|