C24H24Cl2FN5OS — CID 143795803
2-[4-(3,5-dichlorophenyl)piperazin-1-yl]-N-[(1E,3Z,7E)-7-fluorocycloocta-1,3,7-trien-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 143795803) has the molecular formula C24H24Cl2FN5OS and a molecular weight of 520.46 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorophenyl)piperazin-1-yl]-N-[(1E,3Z,7E)-7-fluorocycloocta-1,3,7-trien-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-[4-(3,5-dichlorophenyl)piperazin-1-yl]-N-[(1E,3Z,7E)-7-fluorocycloocta-1,3,7-trien-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143795803 |
| Molecular Formula | C24H24Cl2FN5OS |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 2-[4-(3,5-dichlorophenyl)piperazin-1-yl]-N-[(1E,3Z,7E)-7-fluorocycloocta-1,3,7-trien-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | O=S1CCc2nc(N3CCN(c4cc(Cl)cc(Cl)c4)CC3)nc(NC3=C/C=C\CC/C(F)=C\3)c21 |
| InChI | InChI=1S/C24H24Cl2FN5OS/c25-16-12-17(26)14-20(13-16)31-7-9-32(10-8-31)24-29-21-6-11-34(33)22(21)23(30-24)28-19-5-3-1-2-4-18(27)15-19/h1,3,5,12-15H,2,4,6-11H2,(H,28,29,30)/b3-1-,18-15+,19-5+ |
| InChIKey | HCZLOSDCUSPVPN-DNAXHVOXSA-N |
| XLogP | 5.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |