C24H24ClF3N6O3S — CID 66736249
2-[4-(4-aminophenyl)piperazin-1-yl]-N-(3-chlorophenyl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 66736249) has the molecular formula C24H24ClF3N6O3S and a molecular weight of 569.01 g/mol. Its IUPAC name is 2-[4-(4-aminophenyl)piperazin-1-yl]-N-(3-chlorophenyl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(4-aminophenyl)piperazin-1-yl]-N-(3-chlorophenyl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66736249 |
| Molecular Formula | C24H24ClF3N6O3S |
| Molecular Weight | 569.01 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 2-[4-(4-aminophenyl)piperazin-1-yl]-N-(3-chlorophenyl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccc(N2CCN(c3nc4c(c(Nc5cccc(Cl)c5)n3)S(=O)CC4)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23ClN6OS.C2HF3O2/c23-15-2-1-3-17(14-15)25-21-20-19(8-13-31(20)30)26-22(27-21)29-11-9-28(10-12-29)18-6-4-16(24)5-7-18;3-2(4,5)1(6)7/h1-7,14H,8-13,24H2,(H,25,26,27);(H,6,7) |
| InChIKey | QHFQRNUQMGKIIO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.01 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|