C11H18N2S — CID 143797140
N-[(1E,3Z)-2-(4-methylthiomorpholin-3-yl)penta-1,3-dienyl]methanimine (PubChem CID 143797140) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[(1E,3Z)-2-(4-methylthiomorpholin-3-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-(4-methylthiomorpholin-3-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143797140 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(1E,3Z)-2-(4-methylthiomorpholin-3-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)C1CSCCN1C |
| InChI | InChI=1S/C11H18N2S/c1-4-5-10(8-12-2)11-9-14-7-6-13(11)3/h4-5,8,11H,2,6-7,9H2,1,3H3/b5-4-,10-8+ |
| InChIKey | SMFXBXYHMFFJPJ-BTCMVDHLSA-N |
| XLogP | 2.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|