C9H16O2 — CID 143797256
3-methoxy-6,6-dimethylcyclohex-2-en-1-ol (PubChem CID 143797256) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-methoxy-6,6-dimethylcyclohex-2-en-1-ol.
| Compound Name | 3-methoxy-6,6-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 143797256 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-methoxy-6,6-dimethylcyclohex-2-en-1-ol |
| SMILES | COC1=CC(O)C(C)(C)CC1 |
| InChI | InChI=1S/C9H16O2/c1-9(2)5-4-7(11-3)6-8(9)10/h6,8,10H,4-5H2,1-3H3 |
| InChIKey | OOEANIIJGQUDSA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |