C12H13IO2S — CID 143797681
2-(1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite (PubChem CID 143797681) has the molecular formula C12H13IO2S and a molecular weight of 348.21 g/mol. Its IUPAC name is 2-(1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite.
| Compound Name | 2-(1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 143797681 |
| Molecular Formula | C12H13IO2S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2-(1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite |
| SMILES | CC12CCC(=O)C=C1CCC2(O)C#CSI |
| InChI | InChI=1S/C12H13IO2S/c1-11-4-3-10(14)8-9(11)2-5-12(11,15)6-7-16-13/h8,15H,2-5H2,1H3 |
| InChIKey | SNDDQPPINUMBNQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|