C13H13IO3S — CID 143797686
2-(6-formyl-1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite (PubChem CID 143797686) has the molecular formula C13H13IO3S and a molecular weight of 376.22 g/mol. Its IUPAC name is 2-(6-formyl-1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite.
| Compound Name | 2-(6-formyl-1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 143797686 |
| Molecular Formula | C13H13IO3S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 2-(6-formyl-1-hydroxy-7a-methyl-5-oxo-2,3,6,7-tetrahydroinden-1-yl)ethynyl thiohypoiodite |
| SMILES | CC12CC(C=O)C(=O)C=C1CCC2(O)C#CSI |
| InChI | InChI=1S/C13H13IO3S/c1-12-7-9(8-15)11(16)6-10(12)2-3-13(12,17)4-5-18-14/h6,8-9,17H,2-3,7H2,1H3 |
| InChIKey | FARCNXNYZGGBSL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|