C25H38O7 — CID 14379776
methyl 2-acetyloxy-2-[5-acetyloxy-4-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxolan-3-yl]acetate (PubChem CID 14379776) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is methyl 2-acetyloxy-2-[5-acetyloxy-4-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxolan-3-yl]acetate.
| Compound Name | methyl 2-acetyloxy-2-[5-acetyloxy-4-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 14379776 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl 2-acetyloxy-2-[5-acetyloxy-4-(1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl)oxolan-3-yl]acetate |
| SMILES | C=C1CCCC(C)(C)C2CCC(C)(C3C(OC(C)=O)OCC3C(OC(C)=O)C(=O)OC)C12 |
| InChI | InChI=1S/C25H38O7/c1-14-9-8-11-24(4,5)18-10-12-25(6,19(14)18)20-17(13-30-23(20)32-16(3)27)21(22(28)29-7)31-15(2)26/h17-21,23H,1,8-13H2,2-7H3 |
| InChIKey | HNZYGQGIWPGRNP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|