C13H21N3O3 — CID 143799585
tert-butyl N-methyl-N-[4-(methylaminooxymethyl)-2-pyridinyl]carbamate (PubChem CID 143799585) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-(methylaminooxymethyl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-(methylaminooxymethyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 143799585 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | tert-butyl N-methyl-N-[4-(methylaminooxymethyl)-2-pyridinyl]carbamate |
| SMILES | CNOCc1ccnc(N(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C13H21N3O3/c1-13(2,3)19-12(17)16(5)11-8-10(6-7-15-11)9-18-14-4/h6-8,14H,9H2,1-5H3 |
| InChIKey | BKNQECYTVJLLAB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|