C11H12ClN — CID 143804377
5-chloro-4,8-dimethyl-2,3-dihydroquinoline (PubChem CID 143804377) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 5-chloro-4,8-dimethyl-2,3-dihydroquinoline.
| Compound Name | 5-chloro-4,8-dimethyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 143804377 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-chloro-4,8-dimethyl-2,3-dihydroquinoline |
| SMILES | CC1=c2c(Cl)ccc(C)c2=NCC1 |
| InChI | InChI=1S/C11H12ClN/c1-7-5-6-13-11-8(2)3-4-9(12)10(7)11/h3-4H,5-6H2,1-2H3 |
| InChIKey | QGCAUSCJWBUCFU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |