C20H33N3O — CID 143805481
2-methyl-N'-(3-methyl-4-morpholin-4-ylphenyl)-N'-pent-2-en-2-ylpropane-1,3-diamine (PubChem CID 143805481) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-methyl-N'-(3-methyl-4-morpholin-4-ylphenyl)-N'-pent-2-en-2-ylpropane-1,3-diamine.
| Compound Name | 2-methyl-N'-(3-methyl-4-morpholin-4-ylphenyl)-N'-pent-2-en-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143805481 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 2-methyl-N'-(3-methyl-4-morpholin-4-ylphenyl)-N'-pent-2-en-2-ylpropane-1,3-diamine |
| SMILES | CCC=C(C)N(CC(C)CN)c1ccc(N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C20H33N3O/c1-5-6-18(4)23(15-16(2)14-21)19-7-8-20(17(3)13-19)22-9-11-24-12-10-22/h6-8,13,16H,5,9-12,14-15,21H2,1-4H3 |
| InChIKey | XHSVPGCFTRKQNJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|