About N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine
N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine (PubChem CID 143805717) has the molecular formula C16H18F2N2O2
and a molecular weight of 308.33 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine.
Molecular Properties
| Compound Name | N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine |
| PubChem CID | 143805717 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine |
| SMILES | Cc1ccc(F)nc1F.O=CN(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C10H13NO2.C6H5F2N/c12-7-6-11(9-13)8-10-4-2-1-3-5-10;1-4-2-3-5(7)9-6(4)8/h1-5,9,12H,6-8H2;2-3H,1H3 |
| InChIKey | RLZQVHIRXMJDPK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine?
The IUPAC name of N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine (CID 143805717) is N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine.
What is the SMILES notation for N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine?
The canonical SMILES for N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine is Cc1ccc(F)nc1F.O=CN(CCO)Cc1ccccc1.
What is the InChIKey of N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine?
The InChIKey is RLZQVHIRXMJDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C6H5F2N/c12-7-6-11(9-13)8-10-4-2-1-3-5-10;1-4-2-3-5(7)9-6(4)8/h1-5,9,12H,6-8H2;2-3H,1H3.
What are the key properties of N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine?
N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine has a molecular weight of 308.33 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine is sourced from PubChem (CID 143805717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).