C16H18F2N2O2 — CID 143805717
N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine (PubChem CID 143805717) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine |
|---|---|
| PubChem CID | 143805717 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)formamide;2,6-difluoro-3-methylpyridine |
| SMILES | Cc1ccc(F)nc1F.O=CN(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C10H13NO2.C6H5F2N/c12-7-6-11(9-13)8-10-4-2-1-3-5-10;1-4-2-3-5(7)9-6(4)8/h1-5,9,12H,6-8H2;2-3H,1H3 |
| InChIKey | RLZQVHIRXMJDPK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|