C28H35FN4O3 — CID 143178361
N-[3-[2-[benzyl(formyl)amino]ethylamino]propyl]acetamide;2-[(3-fluoro-5-methylphenoxy)methyl]pyridine (PubChem CID 143178361) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[3-[2-[benzyl(formyl)amino]ethylamino]propyl]acetamide;2-[(3-fluoro-5-methylphenoxy)methyl]pyridine.
| Compound Name | N-[3-[2-[benzyl(formyl)amino]ethylamino]propyl]acetamide;2-[(3-fluoro-5-methylphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 143178361 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-[3-[2-[benzyl(formyl)amino]ethylamino]propyl]acetamide;2-[(3-fluoro-5-methylphenoxy)methyl]pyridine |
| SMILES | CC(=O)NCCCNCCN(C=O)Cc1ccccc1.Cc1cc(F)cc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C15H23N3O2.C13H12FNO/c1-14(20)17-9-5-8-16-10-11-18(13-19)12-15-6-3-2-4-7-15;1-10-6-11(14)8-13(7-10)16-9-12-4-2-3-5-15-12/h2-4,6-7,13,16H,5,8-12H2,1H3,(H,17,20);2-8H,9H2,1H3 |
| InChIKey | CQJUUKXRSYOKTB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|