C29H41FN4O3S — CID 143178369
3-[(3-fluoro-5-methylphenoxy)methyl]pyridine;methanol;N-[3-[2-[methyl-(3-methylphenyl)sulfanylamino]ethylamino]propyl]acetamide (PubChem CID 143178369) has the molecular formula C29H41FN4O3S and a molecular weight of 544.74 g/mol. Its IUPAC name is 3-[(3-fluoro-5-methylphenoxy)methyl]pyridine;methanol;N-[3-[2-[methyl-(3-methylphenyl)sulfanylamino]ethylamino]propyl]acetamide.
| Compound Name | 3-[(3-fluoro-5-methylphenoxy)methyl]pyridine;methanol;N-[3-[2-[methyl-(3-methylphenyl)sulfanylamino]ethylamino]propyl]acetamide |
|---|---|
| PubChem CID | 143178369 |
| Molecular Formula | C29H41FN4O3S |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 3-[(3-fluoro-5-methylphenoxy)methyl]pyridine;methanol;N-[3-[2-[methyl-(3-methylphenyl)sulfanylamino]ethylamino]propyl]acetamide |
| SMILES | CC(=O)NCCCNCCN(C)Sc1cccc(C)c1.CO.Cc1cc(F)cc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C15H25N3OS.C13H12FNO.CH4O/c1-13-6-4-7-15(12-13)20-18(3)11-10-16-8-5-9-17-14(2)19;1-10-5-12(14)7-13(6-10)16-9-11-3-2-4-15-8-11;1-2/h4,6-7,12,16H,5,8-11H2,1-3H3,(H,17,19);2-8H,9H2,1H3;2H,1H3 |
| InChIKey | FNIPKLDVEAGQSP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|