C21H23NO — CID 143806381
(3Z)-3-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine (PubChem CID 143806381) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (3Z)-3-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 143806381 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3Z)-3-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2c(c1)/C(=C\CCN(C)C)c1ccccc1C=C2 |
| InChI | InChI=1S/C21H23NO/c1-22(2)14-6-9-20-19-8-5-4-7-16(19)10-11-17-12-13-18(23-3)15-21(17)20/h4-5,7-13,15H,6,14H2,1-3H3/b20-9- |
| InChIKey | IGGUTAVHVCOZOC-UKWGHVSLSA-N |
| XLogP | 4.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|