C21H24NO3P — CID 58600382
N-dimethoxyphosphoryl-N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine (PubChem CID 58600382) has the molecular formula C21H24NO3P and a molecular weight of 369.40 g/mol. Its IUPAC name is N-dimethoxyphosphoryl-N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine.
| Compound Name | N-dimethoxyphosphoryl-N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine |
|---|---|
| PubChem CID | 58600382 |
| Molecular Formula | C21H24NO3P |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-dimethoxyphosphoryl-N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine |
| SMILES | COP(=O)(OC)N(C)CCC=C1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C21H24NO3P/c1-22(26(23,24-2)25-3)16-8-13-21-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)21/h4-7,9-15H,8,16H2,1-3H3 |
| InChIKey | ZOXXPUNHRWQECN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|