C19H20ClNOS — CID 1229965
(3Z)-3-(2-chloro-6-methoxythioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 1229965) has the molecular formula C19H20ClNOS and a molecular weight of 345.90 g/mol. Its IUPAC name is (3Z)-3-(2-chloro-6-methoxythioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-(2-chloro-6-methoxythioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 1229965 |
| Molecular Formula | C19H20ClNOS |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3Z)-3-(2-chloro-6-methoxythioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2c(c1)Sc1ccc(Cl)cc1/C2=C\CCN(C)C |
| InChI | InChI=1S/C19H20ClNOS/c1-21(2)10-4-5-15-16-8-7-14(22-3)12-19(16)23-18-9-6-13(20)11-17(15)18/h5-9,11-12H,4,10H2,1-3H3/b15-5- |
| InChIKey | ONOMNQGGUQOEPT-WCSRMQSCSA-N |
| XLogP | 5.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|