C18H18ClNOS — CID 826540
(9E)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol (PubChem CID 826540) has the molecular formula C18H18ClNOS and a molecular weight of 331.87 g/mol. Its IUPAC name is (9E)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol.
| Compound Name | (9E)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol |
|---|---|
| PubChem CID | 826540 |
| Molecular Formula | C18H18ClNOS |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (9E)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol |
| SMILES | CN(C)CC/C=C1\c2cc(O)ccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNOS/c1-20(2)9-3-4-14-15-10-12(19)5-7-17(15)22-18-8-6-13(21)11-16(14)18/h4-8,10-11,21H,3,9H2,1-2H3/b14-4- |
| InChIKey | ABKZMYZDVYTHFV-CPSFFCFKSA-N |
| XLogP | 4.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|